C18H16F3N3O2 — CID 47982802
1-(quinazolin-4-ylamino)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol (PubChem CID 47982802) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 1-(quinazolin-4-ylamino)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(quinazolin-4-ylamino)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 47982802 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(quinazolin-4-ylamino)-3-[3-(trifluoromethyl)phenoxy]propan-2-ol |
| SMILES | OC(CNc1ncnc2ccccc12)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N3O2/c19-18(20,21)12-4-3-5-14(8-12)26-10-13(25)9-22-17-15-6-1-2-7-16(15)23-11-24-17/h1-8,11,13,25H,9-10H2,(H,22,23,24) |
| InChIKey | MOJIGUZFOLWZAJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |