C21H19N5OS — CID 4798796
2-pyrrol-1-yl-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzohydrazide (PubChem CID 4798796) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-pyrrol-1-yl-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzohydrazide.
| Compound Name | 2-pyrrol-1-yl-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 4798796 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-pyrrol-1-yl-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc2sc3c(c12)CCCC3)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C21H19N5OS/c27-20(14-7-1-3-9-16(14)26-11-5-6-12-26)25-24-19-18-15-8-2-4-10-17(15)28-21(18)23-13-22-19/h1,3,5-7,9,11-13H,2,4,8,10H2,(H,25,27)(H,22,23,24) |
| InChIKey | WZGHMCKRFSAMOC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|