About 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide
3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 4798996) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide |
| PubChem CID | 4798996 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C16H19N3O3/c1-11-15(12(2)22-18-11)16(20)17-13-5-3-4-6-14(13)19-7-9-21-10-8-19/h3-6H,7-10H2,1-2H3,(H,17,20) |
| InChIKey | GZGCECPZMBRIOQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide?
The IUPAC name of 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide (CID 4798996) is 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)Nc1ccccc1N1CCOCC1.
What is the InChIKey of 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide?
The InChIKey is GZGCECPZMBRIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-11-15(12(2)22-18-11)16(20)17-13-5-3-4-6-14(13)19-7-9-21-10-8-19/h3-6H,7-10H2,1-2H3,(H,17,20).
What are the key properties of 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide?
3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide has a molecular weight of 301.35 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 4798996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).