C12H18N6 — CID 4799062
6,12-diethyl-5,6,8,10,12,13-hexazatricyclo[9.3.0.03,7]tetradeca-1(11),3(7),4,13-tetraene (PubChem CID 4799062) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 6,12-diethyl-5,6,8,10,12,13-hexazatricyclo[9.3.0.03,7]tetradeca-1(11),3(7),4,13-tetraene.
| Compound Name | 6,12-diethyl-5,6,8,10,12,13-hexazatricyclo[9.3.0.03,7]tetradeca-1(11),3(7),4,13-tetraene |
|---|---|
| PubChem CID | 4799062 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 6,12-diethyl-5,6,8,10,12,13-hexazatricyclo[9.3.0.03,7]tetradeca-1(11),3(7),4,13-tetraene |
| SMILES | CCn1ncc2c1NCNc1c(cnn1CC)C2 |
| InChI | InChI=1S/C12H18N6/c1-3-17-11-9(6-15-17)5-10-7-16-18(4-2)12(10)14-8-13-11/h6-7,13-14H,3-5,8H2,1-2H3 |
| InChIKey | VHBOPURASRCXEY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |