About 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea
1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea (PubChem CID 4799115) has the molecular formula C15H10F2N4OS
and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea |
| PubChem CID | 4799115 |
| Molecular Formula | C15H10F2N4OS |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nc(-c2ccccn2)cs1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H10F2N4OS/c16-9-4-5-11(10(17)7-9)19-14(22)21-15-20-13(8-23-15)12-3-1-2-6-18-12/h1-8H,(H2,19,20,21,22) |
| InChIKey | LGGVJHCTAUPYSX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea (CID 4799115) is 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea is O=C(Nc1nc(-c2ccccn2)cs1)Nc1ccc(F)cc1F.
What is the InChIKey of 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea?
The InChIKey is LGGVJHCTAUPYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N4OS/c16-9-4-5-11(10(17)7-9)19-14(22)21-15-20-13(8-23-15)12-3-1-2-6-18-12/h1-8H,(H2,19,20,21,22).
What are the key properties of 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea?
1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea has a molecular weight of 332.34 g/mol, XLogP of 4.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-3-(4-pyridin-2-yl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 4799115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).