C17H15BrN2OS — CID 4799193
2-bromo-N-ethyl-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 4799193) has the molecular formula C17H15BrN2OS and a molecular weight of 375.29 g/mol. Its IUPAC name is 2-bromo-N-ethyl-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-bromo-N-ethyl-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4799193 |
| Molecular Formula | C17H15BrN2OS |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 2-bromo-N-ethyl-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(C(=O)c1ccccc1Br)c1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C17H15BrN2OS/c1-3-20(16(21)12-8-4-5-9-13(12)18)17-19-15-11(2)7-6-10-14(15)22-17/h4-10H,3H2,1-2H3 |
| InChIKey | UKTJTSRARINKSL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |