C17H28N2O2 — CID 47998464
1-(2,2-dimethylpropanoyl)-N,N-bis(prop-2-enyl)piperidine-3-carboxamide (PubChem CID 47998464) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N,N-bis(prop-2-enyl)piperidine-3-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N,N-bis(prop-2-enyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47998464 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N,N-bis(prop-2-enyl)piperidine-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CCCN(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H28N2O2/c1-6-10-18(11-7-2)15(20)14-9-8-12-19(13-14)16(21)17(3,4)5/h6-7,14H,1-2,8-13H2,3-5H3 |
| InChIKey | KBBJFGSVZOBJSN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|