C20H18ClNO5 — CID 4800655
[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate (PubChem CID 4800655) has the molecular formula C20H18ClNO5 and a molecular weight of 387.82 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4800655 |
| Molecular Formula | C20H18ClNO5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccccc1Cl)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18ClNO5/c1-13(27-19(23)9-7-15-4-2-3-5-16(15)21)20(24)22-11-14-6-8-17-18(10-14)26-12-25-17/h2-10,13H,11-12H2,1H3,(H,22,24) |
| InChIKey | BFERUQGLXVTKLF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|