C18H22N2O4S2 — CID 4800684
3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 4800684) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4800684 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)NCc3cccs3)c2)CC(C)O1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-13-11-20(12-14(2)24-13)26(22,23)17-7-3-5-15(9-17)18(21)19-10-16-6-4-8-25-16/h3-9,13-14H,10-12H2,1-2H3,(H,19,21) |
| InChIKey | CHFLJAZZRQEGRC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |