C16H13N3O2S — CID 4800914
2-phenoxy-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 4800914) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-phenoxy-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-phenoxy-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4800914 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-phenoxy-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccccc1)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C16H13N3O2S/c20-15(10-21-13-6-2-1-3-7-13)19-16-18-14(11-22-16)12-5-4-8-17-9-12/h1-9,11H,10H2,(H,18,19,20) |
| InChIKey | VSDVEYKBFAEZGZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |