C15H17F2N3O3 — CID 4801078
N-(2,5-difluorophenyl)-2-[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4801078) has the molecular formula C15H17F2N3O3 and a molecular weight of 325.32 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4801078 |
| Molecular Formula | C15H17F2N3O3 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CC1NC(=O)N(CC(=O)Nc2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C15H17F2N3O3/c1-8(2)5-12-14(22)20(15(23)19-12)7-13(21)18-11-6-9(16)3-4-10(11)17/h3-4,6,8,12H,5,7H2,1-2H3,(H,18,21)(H,19,23) |
| InChIKey | FPZWZCIMUMWGOR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|