About [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate (PubChem CID 4801850) has the molecular formula C18H24ClNO3
and a molecular weight of 337.85 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate.
Molecular Properties
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| PubChem CID | 4801850 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| SMILES | CC1CCCC(NC(=O)COC(=O)Cc2ccc(Cl)cc2)C1C |
| InChI | InChI=1S/C18H24ClNO3/c1-12-4-3-5-16(13(12)2)20-17(21)11-23-18(22)10-14-6-8-15(19)9-7-14/h6-9,12-13,16H,3-5,10-11H2,1-2H3,(H,20,21) |
| InChIKey | QAAZZVJTXRRZBX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate?
The IUPAC name of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate (CID 4801850) is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate.
What is the SMILES notation for [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate?
The canonical SMILES for [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate is CC1CCCC(NC(=O)COC(=O)Cc2ccc(Cl)cc2)C1C.
What is the InChIKey of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate?
The InChIKey is QAAZZVJTXRRZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClNO3/c1-12-4-3-5-16(13(12)2)20-17(21)11-23-18(22)10-14-6-8-15(19)9-7-14/h6-9,12-13,16H,3-5,10-11H2,1-2H3,(H,20,21).
What are the key properties of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate?
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate has a molecular weight of 337.85 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate is sourced from PubChem (CID 4801850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).