About [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate
[2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 4802615) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate.
Molecular Properties
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate |
| PubChem CID | 4802615 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OCC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N2O4/c22-17(15-10-20-16-9-5-4-8-14(15)16)12-25-18(23)11-21-19(24)13-6-2-1-3-7-13/h1-10,20H,11-12H2,(H,21,24) |
| InChIKey | TUPWVILEDVLKNA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate?
The IUPAC name of [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate (CID 4802615) is [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate.
What is the SMILES notation for [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate?
The canonical SMILES for [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate is O=C(CNC(=O)c1ccccc1)OCC(=O)c1c[nH]c2ccccc12.
What is the InChIKey of [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate?
The InChIKey is TUPWVILEDVLKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c22-17(15-10-20-16-9-5-4-8-14(15)16)12-25-18(23)11-21-19(24)13-6-2-1-3-7-13/h1-10,20H,11-12H2,(H,21,24).
What are the key properties of [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate?
[2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate has a molecular weight of 336.35 g/mol, XLogP of 2.32, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indol-3-yl)-2-oxoethyl] 2-benzamidoacetate is sourced from PubChem (CID 4802615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).