About 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide
3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 4802963) has the molecular formula C21H21ClN2O5S2
and a molecular weight of 481.00 g/mol. Its IUPAC name is 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide |
| PubChem CID | 4802963 |
| Molecular Formula | C21H21ClN2O5S2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1cc(OC)c(N(C)S(=O)(=O)c2cccc(C(=O)NCc3cccs3)c2)cc1Cl |
| InChI | InChI=1S/C21H21ClN2O5S2/c1-24(18-11-17(22)19(28-2)12-20(18)29-3)31(26,27)16-8-4-6-14(10-16)21(25)23-13-15-7-5-9-30-15/h4-12H,13H2,1-3H3,(H,23,25) |
| InChIKey | AJHQEQLGRJJKPR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide?
The IUPAC name of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide (CID 4802963) is 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide.
What is the SMILES notation for 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide?
The canonical SMILES for 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide is COc1cc(OC)c(N(C)S(=O)(=O)c2cccc(C(=O)NCc3cccs3)c2)cc1Cl.
What is the InChIKey of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide?
The InChIKey is AJHQEQLGRJJKPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClN2O5S2/c1-24(18-11-17(22)19(28-2)12-20(18)29-3)31(26,27)16-8-4-6-14(10-16)21(25)23-13-15-7-5-9-30-15/h4-12H,13H2,1-3H3,(H,23,25).
What are the key properties of 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide?
3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide has a molecular weight of 481.00 g/mol, XLogP of 4.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-2,4-dimethoxyphenyl)-methylsulfamoyl]-N-(thiophen-2-ylmethyl)benzamide is sourced from PubChem (CID 4802963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).