C16H12FN3O2S — CID 4803466
2-(2-fluorophenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 4803466) has the molecular formula C16H12FN3O2S and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4803466 |
| Molecular Formula | C16H12FN3O2S |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccccc1F)Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C16H12FN3O2S/c17-11-5-1-2-7-14(11)22-9-15(21)20-16-19-13(10-23-16)12-6-3-4-8-18-12/h1-8,10H,9H2,(H,19,20,21) |
| InChIKey | VHXHHYPHXNWUOP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |