About 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide
2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide (PubChem CID 4803987) has the molecular formula C14H16N2OS2
and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide |
| PubChem CID | 4803987 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide |
| SMILES | Cc1csc(SCC(=O)NC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2OS2/c1-10-8-18-14(15-10)19-9-13(17)16-11(2)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3,(H,16,17) |
| InChIKey | PAVOPLAZSHJCCM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide?
The IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide (CID 4803987) is 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide.
What is the SMILES notation for 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide?
The canonical SMILES for 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide is Cc1csc(SCC(=O)NC(C)c2ccccc2)n1.
What is the InChIKey of 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide?
The InChIKey is PAVOPLAZSHJCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2OS2/c1-10-8-18-14(15-10)19-9-13(17)16-11(2)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3,(H,16,17).
What are the key properties of 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide?
2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide has a molecular weight of 292.43 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-N-(1-phenylethyl)acetamide is sourced from PubChem (CID 4803987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).