About phthalaldehyde
phthalaldehyde (PubChem CID 4807) has the molecular formula C8H6O2
and a molecular weight of 134.13 g/mol. Its IUPAC name is phthalaldehyde.
Molecular Properties
| Compound Name | phthalaldehyde |
| PubChem CID | 4807 |
| Molecular Formula | C8H6O2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | phthalaldehyde |
| SMILES | O=Cc1ccccc1C=O |
| InChI | InChI=1S/C8H6O2/c9-5-7-3-1-2-4-8(7)6-10/h1-6H |
| InChIKey | ZWLUXSQADUDCSB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze phthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalaldehyde?
The IUPAC name of phthalaldehyde (CID 4807) is phthalaldehyde.
What is the SMILES notation for phthalaldehyde?
The canonical SMILES for phthalaldehyde is O=Cc1ccccc1C=O.
What is the InChIKey of phthalaldehyde?
The InChIKey is ZWLUXSQADUDCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2/c9-5-7-3-1-2-4-8(7)6-10/h1-6H.
What are the key properties of phthalaldehyde?
phthalaldehyde has a molecular weight of 134.13 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phthalaldehyde is sourced from PubChem (CID 4807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).