C33H64Br2N2 — CID 48073
Ammonium, trimethylenebis(1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)propyl)bis(dimethyl-, dibromide, dihydrate (PubChem CID 48073) has the molecular formula C33H64Br2N2 and a molecular weight of 648.70 g/mol. Its IUPAC name is 3-[dimethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azaniumyl]propyl-dimethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azanium dibromide.
| Compound Name | Ammonium, trimethylenebis(1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)propyl)bis(dimethyl-, dibromide, dihydrate |
|---|---|
| PubChem CID | 48073 |
| Molecular Formula | C33H64Br2N2 |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | 3-[dimethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azaniumyl]propyl-dimethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azanium dibromide |
| SMILES | CC1=C(C(CCC1)(C)C)CCC(C)[N+](C)(C)CCC[N+](C)(C)C(C)CCC2=C(CCCC2(C)C)C.[Br-].[Br-] |
| InChIKey | FATOUCXKYXMOKY-UHFFFAOYSA-L |
| XLogP | N/A |
| TPSA | 0.00 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | 698 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|