C26H25ClN2O4 — CID 4807327
methyl 2-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate (PubChem CID 4807327) has the molecular formula C26H25ClN2O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is methyl 2-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 4807327 |
| Molecular Formula | C26H25ClN2O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 2-[[3-[(2-chlorobenzoyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CC(NC(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C26H25ClN2O4/c1-33-26(32)23(16-18-10-4-2-5-11-18)28-24(30)17-22(19-12-6-3-7-13-19)29-25(31)20-14-8-9-15-21(20)27/h2-15,22-23H,16-17H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | WGNIHFWXLCMSFD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |