C18H16FN3O4S2 — CID 4809346
N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 4809346) has the molecular formula C18H16FN3O4S2 and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 4809346 |
| Molecular Formula | C18H16FN3O4S2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NCCN1C(=O)SC(=Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H16FN3O4S2/c1-11-10-27-17(25)22(11)9-15(23)20-6-7-21-16(24)14(28-18(21)26)8-12-2-4-13(19)5-3-12/h2-5,8,10H,6-7,9H2,1H3,(H,20,23) |
| InChIKey | ZIRLLAXQIGJQAA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|