C12H10ClNOS — CID 4810608
N-(3-chlorophenyl)-5-methylthiophene-2-carboxamide (PubChem CID 4810608) has the molecular formula C12H10ClNOS and a molecular weight of 251.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 4810608 |
| Molecular Formula | C12H10ClNOS |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | N-(3-chlorophenyl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C12H10ClNOS/c1-8-5-6-11(16-8)12(15)14-10-4-2-3-9(13)7-10/h2-7H,1H3,(H,14,15) |
| InChIKey | JILDHXRJMZGOED-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |