About N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide
N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (PubChem CID 4811965) has the molecular formula C16H19Cl2N3O2
and a molecular weight of 356.25 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| PubChem CID | 4811965 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| SMILES | O=C(Cn1ncc(Cl)c(Cl)c1=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-12-7-19-21(15(23)14(12)18)8-13(22)20-16-4-9-1-10(5-16)3-11(2-9)6-16/h7,9-11H,1-6,8H2,(H,20,22) |
| InChIKey | CXHMDDUVFBXFQQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
The IUPAC name of N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (CID 4811965) is N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide.
What is the SMILES notation for N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
The canonical SMILES for N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide is O=C(Cn1ncc(Cl)c(Cl)c1=O)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
The InChIKey is CXHMDDUVFBXFQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2N3O2/c17-12-7-19-21(15(23)14(12)18)8-13(22)20-16-4-9-1-10(5-16)3-11(2-9)6-16/h7,9-11H,1-6,8H2,(H,20,22).
What are the key properties of N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide?
N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide has a molecular weight of 356.25 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide is sourced from PubChem (CID 4811965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).