C19H24N4OS — CID 4814580
2-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide (PubChem CID 4814580) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 4814580 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[(5-cyclohexyl-1-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nc(C2CCCCC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H24N4OS/c1-2-13-20-17(24)14-25-19-21-18(15-9-5-3-6-10-15)23(22-19)16-11-7-4-8-12-16/h2,4,7-8,11-12,15H,1,3,5-6,9-10,13-14H2,(H,20,24) |
| InChIKey | SGISSCLFJRSTFB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|