C23H21FN2O4 — CID 4815247
3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 4815247) has the molecular formula C23H21FN2O4 and a molecular weight of 408.43 g/mol. Its IUPAC name is 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4815247 |
| Molecular Formula | C23H21FN2O4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(Cc2cc(=O)oc3cc(C)c(C)cc23)C1=O |
| InChI | InChI=1S/C23H21FN2O4/c1-4-23(16-5-7-17(24)8-6-16)21(28)26(22(29)25-23)12-15-11-20(27)30-19-10-14(3)13(2)9-18(15)19/h5-11H,4,12H2,1-3H3,(H,25,29) |
| InChIKey | OCAOSQZMNLYBJZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|