C14H13BN2O3S — CID 481709
2-(Toluene-4-sulfonyl)-2H-benzo(D)(1,2,3)diazaborinin-1-OL (PubChem CID 481709) has the molecular formula C14H13BN2O3S and a molecular weight of 300.10 g/mol. Its IUPAC name is 1-hydroxy-2-(4-methylphenyl)sulfonyl-2,3,1-benzodiazaborinine.
| Compound Name | 2-(Toluene-4-sulfonyl)-2H-benzo(D)(1,2,3)diazaborinin-1-OL |
|---|---|
| PubChem CID | 481709 |
| Molecular Formula | C14H13BN2O3S |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-hydroxy-2-(4-methylphenyl)sulfonyl-2,3,1-benzodiazaborinine |
| SMILES | B1(C2=CC=CC=C2C=NN1S(=O)(=O)C3=CC=C(C=C3)C)O |
| InChI | InChI=1S/C14H13BN2O3S/c1-11-6-8-13(9-7-11)21(19,20)17-15(18)14-5-3-2-4-12(14)10-16-17/h2-10,18H,1H3 |
| InChIKey | UQIDNSKBUXCODH-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 497 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|