C21H25N3O — CID 4818334
1-(2,3-dihydroindol-1-yl)-2-(4-phenylpiperazin-1-yl)propan-1-one (PubChem CID 4818334) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-(4-phenylpiperazin-1-yl)propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-(4-phenylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 4818334 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-(4-phenylpiperazin-1-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCc2ccccc21)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3O/c1-17(21(25)24-12-11-18-7-5-6-10-20(18)24)22-13-15-23(16-14-22)19-8-3-2-4-9-19/h2-10,17H,11-16H2,1H3 |
| InChIKey | VIGVYWOCZRVKPA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |