C32H49N3O6 — CID 481870
1,1-dimethylpropyl N-[(1S,2R)-1-benzyl-3-[[(2R,3S)-3-(1,1-dimethylpropoxycarbonylamino)-2-hydroxy-4-phenyl-butyl]amino]-2-hydroxy-propyl]carbamate (PubChem CID 481870) has the molecular formula C32H49N3O6 and a molecular weight of 571.70 g/mol. Its IUPAC name is 2-methylbutan-2-yl N-[(2S,3R)-3-hydroxy-4-[[(2R,3S)-2-hydroxy-3-(2-methylbutan-2-yloxycarbonylamino)-4-phenylbutyl]amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | 1,1-dimethylpropyl N-[(1S,2R)-1-benzyl-3-[[(2R,3S)-3-(1,1-dimethylpropoxycarbonylamino)-2-hydroxy-4-phenyl-butyl]amino]-2-hydroxy-propyl]carbamate |
|---|---|
| PubChem CID | 481870 |
| Molecular Formula | C32H49N3O6 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | 2-methylbutan-2-yl N-[(2S,3R)-3-hydroxy-4-[[(2R,3S)-2-hydroxy-3-(2-methylbutan-2-yloxycarbonylamino)-4-phenylbutyl]amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CCC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@@H](CNC[C@H]([C@H](CC2=CC=CC=C2)NC(=O)OC(C)(C)CC)O)O |
| InChI | InChI=1S/C32H49N3O6/c1-7-31(3,4)40-29(38)34-25(19-23-15-11-9-12-16-23)27(36)21-33-22-28(37)26(20-24-17-13-10-14-18-24)35-30(39)41-32(5,6)8-2/h9-18,25-28,33,36-37H,7-8,19-22H2,1-6H3,(H,34,38)(H,35,39)/t25-,26-,27+,28+/m0/s1 |
| InChIKey | MLIKYDGNCFBWTP-YVHASNINSA-N |
| XLogP | 5.10 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | 703 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |