C24H32N4O3 — CID 4818824
2-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4818824) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4818824 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H32N4O3/c1-17-13-18(2)24(19(3)14-17)26-23(30)16-27(4)15-22(29)25-20-5-7-21(8-6-20)28-9-11-31-12-10-28/h5-8,13-14H,9-12,15-16H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | NLZPYJBIYDHSMV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|