C19H18N2O2 — CID 4819137
2-(3-cyanophenoxy)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 4819137) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(3-cyanophenoxy)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(3-cyanophenoxy)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 4819137 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(3-cyanophenoxy)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | N#Cc1cccc(OCC(=O)NC2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H18N2O2/c20-12-14-5-3-8-16(11-14)23-13-19(22)21-18-10-4-7-15-6-1-2-9-17(15)18/h1-3,5-6,8-9,11,18H,4,7,10,13H2,(H,21,22) |
| InChIKey | KXFNMNFHQRWFTL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |