C14H18N4OS — CID 4819460
N-(1-cyanocyclohexyl)-2-pyrimidin-2-ylsulfanylpropanamide (PubChem CID 4819460) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-pyrimidin-2-ylsulfanylpropanamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-pyrimidin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 4819460 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-pyrimidin-2-ylsulfanylpropanamide |
| SMILES | CC(Sc1ncccn1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C14H18N4OS/c1-11(20-13-16-8-5-9-17-13)12(19)18-14(10-15)6-3-2-4-7-14/h5,8-9,11H,2-4,6-7H2,1H3,(H,18,19) |
| InChIKey | VWMDOSKRIFDWHR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |