C17H20N2O3S — CID 4824143
N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pentanamide (PubChem CID 4824143) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pentanamide.
| Compound Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 4824143 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCN1C(=O)SC(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H20N2O3S/c1-2-3-9-15(20)18-10-11-19-16(21)14(23-17(19)22)12-13-7-5-4-6-8-13/h4-8,12H,2-3,9-11H2,1H3,(H,18,20) |
| InChIKey | FRURMHBJXQKXOO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|