About 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine
1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine (PubChem CID 4824386) has the molecular formula C19H22N2O7S
and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine.
Molecular Properties
| Compound Name | 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine |
| PubChem CID | 4824386 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine |
| SMILES | COc1cc(OC)cc(Oc2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22N2O7S/c1-26-14-10-15(27-2)12-16(11-14)28-19-7-6-17(13-18(19)21(22)23)29(24,25)20-8-4-3-5-9-20/h6-7,10-13H,3-5,8-9H2,1-2H3 |
| InChIKey | NCVSUPRIRCQPKC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine?
The IUPAC name of 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine (CID 4824386) is 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine.
What is the SMILES notation for 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine?
The canonical SMILES for 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine is COc1cc(OC)cc(Oc2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])c1.
What is the InChIKey of 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine?
The InChIKey is NCVSUPRIRCQPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O7S/c1-26-14-10-15(27-2)12-16(11-14)28-19-7-6-17(13-18(19)21(22)23)29(24,25)20-8-4-3-5-9-20/h6-7,10-13H,3-5,8-9H2,1-2H3.
What are the key properties of 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine?
1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine has a molecular weight of 422.46 g/mol, XLogP of 3.58, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dimethoxyphenoxy)-3-nitrophenyl]sulfonylpiperidine is sourced from PubChem (CID 4824386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).