C23H24N4O3 — CID 4824587
N-naphthalen-1-yl-2-[4-(4-nitrophenyl)piperazin-1-yl]propanamide (PubChem CID 4824587) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[4-(4-nitrophenyl)piperazin-1-yl]propanamide.
| Compound Name | N-naphthalen-1-yl-2-[4-(4-nitrophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 4824587 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-naphthalen-1-yl-2-[4-(4-nitrophenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1cccc2ccccc12)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H24N4O3/c1-17(23(28)24-22-8-4-6-18-5-2-3-7-21(18)22)25-13-15-26(16-14-25)19-9-11-20(12-10-19)27(29)30/h2-12,17H,13-16H2,1H3,(H,24,28) |
| InChIKey | XMLLYZCEVBSZOA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|