C15H17N5OS — CID 4825435
N,N-bis(prop-2-enyl)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4825435) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N,N-bis(prop-2-enyl)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4825435 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N,N-bis(prop-2-enyl)-2-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1n[nH]c(-c2ccncc2)n1 |
| InChI | InChI=1S/C15H17N5OS/c1-3-9-20(10-4-2)13(21)11-22-15-17-14(18-19-15)12-5-7-16-8-6-12/h3-8H,1-2,9-11H2,(H,17,18,19) |
| InChIKey | ZRXMIVNOVTXLPH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|