About (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol
(5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 4825630) has the molecular formula C16H11F3N2O2
and a molecular weight of 320.27 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 4825630 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1cccc(C(F)(F)F)c1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H11F3N2O2/c17-16(18,19)12-8-4-7-11(9-12)13(22)15-21-20-14(23-15)10-5-2-1-3-6-10/h1-9,13,22H |
| InChIKey | PWXVGGIRINRFAX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol?
The IUPAC name of (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol (CID 4825630) is (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol is OC(c1cccc(C(F)(F)F)c1)c1nnc(-c2ccccc2)o1.
What is the InChIKey of (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol?
The InChIKey is PWXVGGIRINRFAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2O2/c17-16(18,19)12-8-4-7-11(9-12)13(22)15-21-20-14(23-15)10-5-2-1-3-6-10/h1-9,13,22H.
What are the key properties of (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol?
(5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol has a molecular weight of 320.27 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,3,4-oxadiazol-2-yl)-[3-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 4825630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).