About 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one
1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one (PubChem CID 4825774) has the molecular formula C16H15N3O4
and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one |
| PubChem CID | 4825774 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one |
| SMILES | O=C(Cn1cc([N+](=O)[O-])ccc1=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H15N3O4/c20-15-8-7-13(19(22)23)10-17(15)11-16(21)18-9-3-5-12-4-1-2-6-14(12)18/h1-2,4,6-8,10H,3,5,9,11H2 |
| InChIKey | BGZRFKORQMKTST-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one?
The IUPAC name of 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one (CID 4825774) is 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one.
What is the SMILES notation for 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one?
The canonical SMILES for 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one is O=C(Cn1cc([N+](=O)[O-])ccc1=O)N1CCCc2ccccc21.
What is the InChIKey of 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one?
The InChIKey is BGZRFKORQMKTST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O4/c20-15-8-7-13(19(22)23)10-17(15)11-16(21)18-9-3-5-12-4-1-2-6-14(12)18/h1-2,4,6-8,10H,3,5,9,11H2.
What are the key properties of 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one?
1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one has a molecular weight of 313.31 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one is sourced from PubChem (CID 4825774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).