About 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide
2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide (PubChem CID 4826105) has the molecular formula C18H18N2O3
and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide.
Molecular Properties
| Compound Name | 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide |
| PubChem CID | 4826105 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H18N2O3/c19-18(22)14-8-2-4-10-16(14)23-12-17(21)20-11-5-7-13-6-1-3-9-15(13)20/h1-4,6,8-10H,5,7,11-12H2,(H2,19,22) |
| InChIKey | UXMVTMQRUJEKDD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide?
The IUPAC name of 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide (CID 4826105) is 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide.
What is the SMILES notation for 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide?
The canonical SMILES for 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide is NC(=O)c1ccccc1OCC(=O)N1CCCc2ccccc21.
What is the InChIKey of 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide?
The InChIKey is UXMVTMQRUJEKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3/c19-18(22)14-8-2-4-10-16(14)23-12-17(21)20-11-5-7-13-6-1-3-9-15(13)20/h1-4,6,8-10H,5,7,11-12H2,(H2,19,22).
What are the key properties of 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide?
2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide has a molecular weight of 310.35 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]benzamide is sourced from PubChem (CID 4826105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).