C15H9ClN4O3S — CID 4826312
2-chloro-4-nitro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 4826312) has the molecular formula C15H9ClN4O3S and a molecular weight of 360.78 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4826312 |
| Molecular Formula | C15H9ClN4O3S |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-chloro-4-nitro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccn2)cs1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H9ClN4O3S/c16-11-7-9(20(22)23)4-5-10(11)14(21)19-15-18-13(8-24-15)12-3-1-2-6-17-12/h1-8H,(H,18,19,21) |
| InChIKey | RRTJOQVRJNMHFX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|