C12H15Cl2N3O2 — CID 4826952
2-[2-(azepan-1-yl)-2-oxoethyl]-4,5-dichloropyridazin-3-one (PubChem CID 4826952) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)-2-oxoethyl]-4,5-dichloropyridazin-3-one.
| Compound Name | 2-[2-(azepan-1-yl)-2-oxoethyl]-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 4826952 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-[2-(azepan-1-yl)-2-oxoethyl]-4,5-dichloropyridazin-3-one |
| SMILES | O=C(Cn1ncc(Cl)c(Cl)c1=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c13-9-7-15-17(12(19)11(9)14)8-10(18)16-5-3-1-2-4-6-16/h7H,1-6,8H2 |
| InChIKey | SOAFEFWBXCRSGD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |