C19H19ClN2O3 — CID 4827116
N-[4-(2-acetylanilino)-4-oxobutyl]-4-chlorobenzamide (PubChem CID 4827116) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[4-(2-acetylanilino)-4-oxobutyl]-4-chlorobenzamide.
| Compound Name | N-[4-(2-acetylanilino)-4-oxobutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 4827116 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[4-(2-acetylanilino)-4-oxobutyl]-4-chlorobenzamide |
| SMILES | CC(=O)c1ccccc1NC(=O)CCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O3/c1-13(23)16-5-2-3-6-17(16)22-18(24)7-4-12-21-19(25)14-8-10-15(20)11-9-14/h2-3,5-6,8-11H,4,7,12H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | FOXRAFCTJIBTCD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|