About [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate
[2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate (PubChem CID 4828986) has the molecular formula C16H21NO3S
and a molecular weight of 307.41 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate.
Molecular Properties
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate |
| PubChem CID | 4828986 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)OCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H21NO3S/c1-21-14-9-5-4-8-13(14)16(19)20-12-15(18)17-10-6-2-3-7-11-17/h4-5,8-9H,2-3,6-7,10-12H2,1H3 |
| InChIKey | PFBKZOWQCOZQEP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate?
The IUPAC name of [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate (CID 4828986) is [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate.
What is the SMILES notation for [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate?
The canonical SMILES for [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate is CSc1ccccc1C(=O)OCC(=O)N1CCCCCC1.
What is the InChIKey of [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate?
The InChIKey is PFBKZOWQCOZQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3S/c1-21-14-9-5-4-8-13(14)16(19)20-12-15(18)17-10-6-2-3-7-11-17/h4-5,8-9H,2-3,6-7,10-12H2,1H3.
What are the key properties of [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate?
[2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate has a molecular weight of 307.41 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azepan-1-yl)-2-oxoethyl] 2-methylsulfanylbenzoate is sourced from PubChem (CID 4828986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).