About tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane
tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane (PubChem CID 4829703) has the molecular formula C23H28NO2P
and a molecular weight of 381.46 g/mol. Its IUPAC name is tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane.
Molecular Properties
| Compound Name | tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane |
| PubChem CID | 4829703 |
| Molecular Formula | C23H28NO2P |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane |
| SMILES | Cc1ccc(N=P(Oc2ccccc2)(c2ccc(C)o2)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C23H28NO2P/c1-17-12-14-21(18(2)16-17)24-27(23(4,5)6,22-15-13-19(3)25-22)26-20-10-8-7-9-11-20/h7-16H,1-6H3 |
| InChIKey | SWBZDPRYUMBZKS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane?
The IUPAC name of tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane (CID 4829703) is tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane.
What is the SMILES notation for tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane?
The canonical SMILES for tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane is Cc1ccc(N=P(Oc2ccccc2)(c2ccc(C)o2)C(C)(C)C)c(C)c1.
What is the InChIKey of tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane?
The InChIKey is SWBZDPRYUMBZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28NO2P/c1-17-12-14-21(18(2)16-17)24-27(23(4,5)6,22-15-13-19(3)25-22)26-20-10-8-7-9-11-20/h7-16H,1-6H3.
What are the key properties of tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane?
tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane has a molecular weight of 381.46 g/mol, XLogP of 7.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(2,4-dimethylphenyl)imino-(5-methylfuran-2-yl)-phenoxy-λ5-phosphane is sourced from PubChem (CID 4829703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).