About 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one
6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4829978) has the molecular formula C14H7ClF2N2OS
and a molecular weight of 324.74 g/mol. Its IUPAC name is 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| PubChem CID | 4829978 |
| Molecular Formula | C14H7ClF2N2OS |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2cc(Cl)ccc2[nH]c(=S)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C14H7ClF2N2OS/c15-7-1-3-11-9(5-7)13(20)19(14(21)18-11)12-4-2-8(16)6-10(12)17/h1-6H,(H,18,21) |
| InChIKey | HPPVPBXAAJTMNK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one?
The IUPAC name of 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one (CID 4829978) is 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one.
What is the SMILES notation for 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one?
The canonical SMILES for 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one is O=c1c2cc(Cl)ccc2[nH]c(=S)n1-c1ccc(F)cc1F.
What is the InChIKey of 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one?
The InChIKey is HPPVPBXAAJTMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7ClF2N2OS/c15-7-1-3-11-9(5-7)13(20)19(14(21)18-11)12-4-2-8(16)6-10(12)17/h1-6H,(H,18,21).
What are the key properties of 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one?
6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one has a molecular weight of 324.74 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(2,4-difluorophenyl)-2-sulfanylidene-1H-quinazolin-4-one is sourced from PubChem (CID 4829978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).