C21H26N4S — CID 4830117
N-cyclohexyl-N'-(6-phenylthieno[2,3-d]pyrimidin-4-yl)propane-1,3-diamine (PubChem CID 4830117) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-cyclohexyl-N'-(6-phenylthieno[2,3-d]pyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N-cyclohexyl-N'-(6-phenylthieno[2,3-d]pyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 4830117 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-cyclohexyl-N'-(6-phenylthieno[2,3-d]pyrimidin-4-yl)propane-1,3-diamine |
| SMILES | c1ccc(-c2cc3c(NCCCNC4CCCCC4)ncnc3s2)cc1 |
| InChI | InChI=1S/C21H26N4S/c1-3-8-16(9-4-1)19-14-18-20(24-15-25-21(18)26-19)23-13-7-12-22-17-10-5-2-6-11-17/h1,3-4,8-9,14-15,17,22H,2,5-7,10-13H2,(H,23,24,25) |
| InChIKey | WGPBUHKBJYHNJO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|