C20H20Cl3NO6 — CID 4831116
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 4831116) has the molecular formula C20H20Cl3NO6 and a molecular weight of 476.74 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 4831116 |
| Molecular Formula | C20H20Cl3NO6 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OC(C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C20H20Cl3NO6/c1-10(20(26)24-15-9-13(22)12(21)8-14(15)23)30-18(25)7-11-5-16(27-2)19(29-4)17(6-11)28-3/h5-6,8-10H,7H2,1-4H3,(H,24,26) |
| InChIKey | YSFMOXUMYDEHOD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|