C24H18N4O2S2 — CID 4831191
4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethyl-2-nitroaniline (PubChem CID 4831191) has the molecular formula C24H18N4O2S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethyl-2-nitroaniline.
| Compound Name | 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethyl-2-nitroaniline |
|---|---|
| PubChem CID | 4831191 |
| Molecular Formula | C24H18N4O2S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethyl-2-nitroaniline |
| SMILES | CN(C)c1ccc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N4O2S2/c1-27(2)19-12-11-15(14-20(19)28(29)30)13-16(23-25-17-7-3-5-9-21(17)31-23)24-26-18-8-4-6-10-22(18)32-24/h3-14H,1-2H3 |
| InChIKey | BXUQGIDWAOBKFR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|