C18H15F3O4 — CID 4831886
(3,5-dimethoxyphenyl) 3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 4831886) has the molecular formula C18H15F3O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) 3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | (3,5-dimethoxyphenyl) 3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4831886 |
| Molecular Formula | C18H15F3O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3,5-dimethoxyphenyl) 3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COc1cc(OC)cc(OC(=O)C=Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H15F3O4/c1-23-14-9-15(24-2)11-16(10-14)25-17(22)8-5-12-3-6-13(7-4-12)18(19,20)21/h3-11H,1-2H3 |
| InChIKey | RKSSJAFCSGPTKL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|