C18H15Cl2FN2O2 — CID 4832172
3-[(3,4-dichlorophenyl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 4832172) has the molecular formula C18H15Cl2FN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4832172 |
| Molecular Formula | C18H15Cl2FN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-5-ethyl-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C18H15Cl2FN2O2/c1-2-18(12-4-6-13(21)7-5-12)16(24)23(17(25)22-18)10-11-3-8-14(19)15(20)9-11/h3-9H,2,10H2,1H3,(H,22,25) |
| InChIKey | UEWUSIWKRZSKPH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|