About O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate
O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate (PubChem CID 4832471) has the molecular formula C10H14N2O2S3
and a molecular weight of 290.44 g/mol. Its IUPAC name is O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate |
| PubChem CID | 4832471 |
| Molecular Formula | C10H14N2O2S3 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SCC(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H14N2O2S3/c1-4-14-10(15)16-5-8(13)12-9-11-6(2)7(3)17-9/h4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | KLXPSPAVOPNDDU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate?
The IUPAC name of O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate (CID 4832471) is O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate.
What is the SMILES notation for O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate?
The canonical SMILES for O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate is CCOC(=S)SCC(=O)Nc1nc(C)c(C)s1.
What is the InChIKey of O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate?
The InChIKey is KLXPSPAVOPNDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S3/c1-4-14-10(15)16-5-8(13)12-9-11-6(2)7(3)17-9/h4-5H2,1-3H3,(H,11,12,13).
What are the key properties of O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate?
O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate has a molecular weight of 290.44 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]sulfanylmethanethioate is sourced from PubChem (CID 4832471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).