About 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol
2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol (PubChem CID 4832651) has the molecular formula C22H22ClN3OS
and a molecular weight of 411.96 g/mol. Its IUPAC name is 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol |
| PubChem CID | 4832651 |
| Molecular Formula | C22H22ClN3OS |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol |
| SMILES | Cc1cc(C)c2nc(SCc3nc4ccc(Cl)cc4n3CCO)cc(C)c2c1 |
| InChI | InChI=1S/C22H22ClN3OS/c1-13-8-15(3)22-17(9-13)14(2)10-21(25-22)28-12-20-24-18-5-4-16(23)11-19(18)26(20)6-7-27/h4-5,8-11,27H,6-7,12H2,1-3H3 |
| InChIKey | PLUGARYXASHOSB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol?
The IUPAC name of 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol (CID 4832651) is 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol.
What is the SMILES notation for 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol?
The canonical SMILES for 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol is Cc1cc(C)c2nc(SCc3nc4ccc(Cl)cc4n3CCO)cc(C)c2c1.
What is the InChIKey of 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol?
The InChIKey is PLUGARYXASHOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3OS/c1-13-8-15(3)22-17(9-13)14(2)10-21(25-22)28-12-20-24-18-5-4-16(23)11-19(18)26(20)6-7-27/h4-5,8-11,27H,6-7,12H2,1-3H3.
What are the key properties of 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol?
2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol has a molecular weight of 411.96 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-chloro-2-[(4,6,8-trimethylquinolin-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol is sourced from PubChem (CID 4832651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).